C18H19N7O3S — CID 134460145
2-(6-aminopurin-9-yl)-5-(indazol-1-ylmethylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 134460145) has the molecular formula C18H19N7O3S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-5-(indazol-1-ylmethylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | 2-(6-aminopurin-9-yl)-5-(indazol-1-ylmethylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 134460145 |
| Molecular Formula | C18H19N7O3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-5-(indazol-1-ylmethylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2C1OC(CSCn2ncc3ccccc32)C(O)C1O |
| InChI | InChI=1S/C18H19N7O3S/c19-16-13-17(21-7-20-16)24(8-22-13)18-15(27)14(26)12(28-18)6-29-9-25-11-4-2-1-3-10(11)5-23-25/h1-5,7-8,12,14-15,18,26-27H,6,9H2,(H2,19,20,21) |
| InChIKey | XSTQDKFPICMOPZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |