C31H44N8O3 — CID 67989184
9-[(3aR,6aR)-6-[[4-(6-tert-butyl-1H-benzimidazol-2-yl)butyl-propan-2-ylamino]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 67989184) has the molecular formula C31H44N8O3 and a molecular weight of 576.75 g/mol. Its IUPAC name is 9-[(3aR,6aR)-6-[[4-(6-tert-butyl-1H-benzimidazol-2-yl)butyl-propan-2-ylamino]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[(3aR,6aR)-6-[[4-(6-tert-butyl-1H-benzimidazol-2-yl)butyl-propan-2-ylamino]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 67989184 |
| Molecular Formula | C31H44N8O3 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | 9-[(3aR,6aR)-6-[[4-(6-tert-butyl-1H-benzimidazol-2-yl)butyl-propan-2-ylamino]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | CC(C)N(CCCCc1nc2ccc(C(C)(C)C)cc2[nH]1)CC1OC(n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C31H44N8O3/c1-18(2)38(13-9-8-10-23-36-20-12-11-19(30(3,4)5)14-21(20)37-23)15-22-25-26(42-31(6,7)41-25)29(40-22)39-17-35-24-27(32)33-16-34-28(24)39/h11-12,14,16-18,22,25-26,29H,8-10,13,15H2,1-7H3,(H,36,37)(H2,32,33,34)/t22?,25-,26-,29?/m1/s1 |
| InChIKey | OEXOMMPJAHXCAB-LGDKYPPGSA-N |
| XLogP | 4.73 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|