C25H30ClF3N8O3 — CID 77390502
2-(6-aminopurin-9-yl)-5-[[4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl-propan-2-ylamino]methyl]oxolane-3,4-diol (PubChem CID 77390502) has the molecular formula C25H30ClF3N8O3 and a molecular weight of 583.02 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-5-[[4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl-propan-2-ylamino]methyl]oxolane-3,4-diol.
| Compound Name | 2-(6-aminopurin-9-yl)-5-[[4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl-propan-2-ylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 77390502 |
| Molecular Formula | C25H30ClF3N8O3 |
| Molecular Weight | 583.02 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-5-[[4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl-propan-2-ylamino]methyl]oxolane-3,4-diol |
| SMILES | CC(C)N(CCCCc1nc2cc(Cl)c(C(F)(F)F)cc2[nH]1)CC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C25H30ClF3N8O3/c1-12(2)36(6-4-3-5-18-34-15-7-13(25(27,28)29)14(26)8-16(15)35-18)9-17-20(38)21(39)24(40-17)37-11-33-19-22(30)31-10-32-23(19)37/h7-8,10-12,17,20-21,24,38-39H,3-6,9H2,1-2H3,(H,34,35)(H2,30,31,32) |
| InChIKey | QKZJEVKFTNGFPT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.02 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|