C25H33N7O5S — CID 77390506
2-(6-aminopurin-9-yl)-5-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfonylmethyl]oxolane-3,4-diol (PubChem CID 77390506) has the molecular formula C25H33N7O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-5-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfonylmethyl]oxolane-3,4-diol.
| Compound Name | 2-(6-aminopurin-9-yl)-5-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfonylmethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 77390506 |
| Molecular Formula | C25H33N7O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-5-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfonylmethyl]oxolane-3,4-diol |
| SMILES | CC(C)(C)c1ccc2nc(CCCCS(=O)(=O)CC3OC(n4cnc5c(N)ncnc54)C(O)C3O)[nH]c2c1 |
| InChI | InChI=1S/C25H33N7O5S/c1-25(2,3)14-7-8-15-16(10-14)31-18(30-15)6-4-5-9-38(35,36)11-17-20(33)21(34)24(37-17)32-13-29-19-22(26)27-12-28-23(19)32/h7-8,10,12-13,17,20-21,24,33-34H,4-6,9,11H2,1-3H3,(H,30,31)(H2,26,27,28) |
| InChIKey | ISADCIUTRWDLMD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|