C33H48N8O3 — CID 126703531
9-[(4R,5R)-5-[(1R)-2-[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-propan-2-ylamino]-1-methoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]purin-6-amine (PubChem CID 126703531) has the molecular formula C33H48N8O3 and a molecular weight of 604.80 g/mol. Its IUPAC name is 9-[(4R,5R)-5-[(1R)-2-[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-propan-2-ylamino]-1-methoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]purin-6-amine.
| Compound Name | 9-[(4R,5R)-5-[(1R)-2-[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-propan-2-ylamino]-1-methoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 126703531 |
| Molecular Formula | C33H48N8O3 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | 9-[(4R,5R)-5-[(1R)-2-[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-propan-2-ylamino]-1-methoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]purin-6-amine |
| SMILES | CO[C@H](CN(C(C)C)C1CC(CCc2nc3ccc(C(C)(C)C)cc3[nH]2)C1)[C@H]1OC(C)(C)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C33H48N8O3/c1-19(2)40(22-13-20(14-22)9-12-26-38-23-11-10-21(32(3,4)5)15-24(23)39-26)16-25(42-8)28-31(44-33(6,7)43-28)41-18-37-27-29(34)35-17-36-30(27)41/h10-11,15,17-20,22,25,28,31H,9,12-14,16H2,1-8H3,(H,38,39)(H2,34,35,36)/t20?,22?,25-,28-,31-/m1/s1 |
| InChIKey | RMYABFHHQHLJTJ-CXEXCPOQSA-N |
| XLogP | 5.37 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |