C30H42N8O2 — CID 145405928
9-[5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-(1-methoxyethyl)amino]methyl]oxolan-2-yl]purin-6-amine (PubChem CID 145405928) has the molecular formula C30H42N8O2 and a molecular weight of 546.72 g/mol. Its IUPAC name is 9-[5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-(1-methoxyethyl)amino]methyl]oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-(1-methoxyethyl)amino]methyl]oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 145405928 |
| Molecular Formula | C30H42N8O2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | 9-[5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-(1-methoxyethyl)amino]methyl]oxolan-2-yl]purin-6-amine |
| SMILES | COC(C)N(CC1CCC(n2cnc3c(N)ncnc32)O1)C1CC(CCc2nc3ccc(C(C)(C)C)cc3[nH]2)C1 |
| InChI | InChI=1S/C30H42N8O2/c1-18(39-5)37(15-22-8-11-26(40-22)38-17-34-27-28(31)32-16-33-29(27)38)21-12-19(13-21)6-10-25-35-23-9-7-20(30(2,3)4)14-24(23)36-25/h7,9,14,16-19,21-22,26H,6,8,10-13,15H2,1-5H3,(H,35,36)(H2,31,32,33) |
| InChIKey | HCJBTYBCEISEPH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|