C30H42N8O2 — CID 144770533
1-[3-[[(5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl-propan-2-ylamino]cyclobutyl]-2-(6-tert-butyl-1H-benzimidazol-2-yl)ethanol (PubChem CID 144770533) has the molecular formula C30H42N8O2 and a molecular weight of 546.72 g/mol. Its IUPAC name is 1-[3-[[(5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl-propan-2-ylamino]cyclobutyl]-2-(6-tert-butyl-1H-benzimidazol-2-yl)ethanol.
| Compound Name | 1-[3-[[(5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl-propan-2-ylamino]cyclobutyl]-2-(6-tert-butyl-1H-benzimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 144770533 |
| Molecular Formula | C30H42N8O2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | 1-[3-[[(5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl-propan-2-ylamino]cyclobutyl]-2-(6-tert-butyl-1H-benzimidazol-2-yl)ethanol |
| SMILES | CC(C)N(CC1CC[C@H](n2cnc3c(N)ncnc32)O1)C1CC(C(O)Cc2nc3ccc(C(C)(C)C)cc3[nH]2)C1 |
| InChI | InChI=1S/C30H42N8O2/c1-17(2)37(14-21-7-9-26(40-21)38-16-34-27-28(31)32-15-33-29(27)38)20-10-18(11-20)24(39)13-25-35-22-8-6-19(30(3,4)5)12-23(22)36-25/h6,8,12,15-18,20-21,24,26,39H,7,9-11,13-14H2,1-5H3,(H,35,36)(H2,31,32,33)/t18?,20?,21?,24?,26-/m1/s1 |
| InChIKey | LKYRKBLBRDLXCK-NTOVKVJBSA-N |
| XLogP | 4.35 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |