C29H41N9O4 — CID 144770559
2-[2-[2-[3-[[[5-(6-aminopurin-9-yl)oxolan-2-yl]amino]-(2-hydroxypropan-2-yl)amino]cyclobutyl]ethyl]-3H-benzimidazol-5-yl]-2-methylpropane-1,3-diol (PubChem CID 144770559) has the molecular formula C29H41N9O4 and a molecular weight of 579.71 g/mol. Its IUPAC name is 2-[2-[2-[3-[[[5-(6-aminopurin-9-yl)oxolan-2-yl]amino]-(2-hydroxypropan-2-yl)amino]cyclobutyl]ethyl]-3H-benzimidazol-5-yl]-2-methylpropane-1,3-diol.
| Compound Name | 2-[2-[2-[3-[[[5-(6-aminopurin-9-yl)oxolan-2-yl]amino]-(2-hydroxypropan-2-yl)amino]cyclobutyl]ethyl]-3H-benzimidazol-5-yl]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 144770559 |
| Molecular Formula | C29H41N9O4 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | 2-[2-[2-[3-[[[5-(6-aminopurin-9-yl)oxolan-2-yl]amino]-(2-hydroxypropan-2-yl)amino]cyclobutyl]ethyl]-3H-benzimidazol-5-yl]-2-methylpropane-1,3-diol |
| SMILES | CC(CO)(CO)c1ccc2nc(CCC3CC(N(NC4CCC(n5cnc6c(N)ncnc65)O4)C(C)(C)O)C3)[nH]c2c1 |
| InChI | InChI=1S/C29H41N9O4/c1-28(2,41)38(36-23-8-9-24(42-23)37-16-33-25-26(30)31-15-32-27(25)37)19-10-17(11-19)4-7-22-34-20-6-5-18(12-21(20)35-22)29(3,13-39)14-40/h5-6,12,15-17,19,23-24,36,39-41H,4,7-11,13-14H2,1-3H3,(H,34,35)(H2,30,31,32) |
| InChIKey | AXGYRGSAUIQFKV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 183.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|