C28H37N9O5 — CID 67975643
[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-[3-[(6-tert-butyl-1H-benzimidazol-2-yl)amino]propyl]carbamic acid (PubChem CID 67975643) has the molecular formula C28H37N9O5 and a molecular weight of 579.66 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-[3-[(6-tert-butyl-1H-benzimidazol-2-yl)amino]propyl]carbamic acid.
| Compound Name | [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-[3-[(6-tert-butyl-1H-benzimidazol-2-yl)amino]propyl]carbamic acid |
|---|---|
| PubChem CID | 67975643 |
| Molecular Formula | C28H37N9O5 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-[3-[(6-tert-butyl-1H-benzimidazol-2-yl)amino]propyl]carbamic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CN(CCCNc1nc3ccc(C(C)(C)C)cc3[nH]1)C(=O)O)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C28H37N9O5/c1-27(2,3)15-7-8-16-17(11-15)35-25(34-16)30-9-6-10-36(26(38)39)12-18-20-21(42-28(4,5)41-20)24(40-18)37-14-33-19-22(29)31-13-32-23(19)37/h7-8,11,13-14,18,20-21,24H,6,9-10,12H2,1-5H3,(H,38,39)(H2,29,31,32)(H2,30,34,35)/t18-,20-,21-,24-/m1/s1 |
| InChIKey | DSLIPOHLUBBQOR-UMCMBGNQSA-N |
| XLogP | 3.48 |
| TPSA | 178.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|