C27H37N7O5 — CID 126713042
2-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]ethyl N-(4-tert-butylphenyl)carbamate (PubChem CID 126713042) has the molecular formula C27H37N7O5 and a molecular weight of 539.64 g/mol. Its IUPAC name is 2-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]ethyl N-(4-tert-butylphenyl)carbamate.
| Compound Name | 2-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]ethyl N-(4-tert-butylphenyl)carbamate |
|---|---|
| PubChem CID | 126713042 |
| Molecular Formula | C27H37N7O5 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 2-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]ethyl N-(4-tert-butylphenyl)carbamate |
| SMILES | CN(CCOC(=O)Nc1ccc(C(C)(C)C)cc1)C[C@H]1OC(n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C27H37N7O5/c1-26(2,3)16-7-9-17(10-8-16)32-25(35)36-12-11-33(6)13-18-20-21(39-27(4,5)38-20)24(37-18)34-15-31-19-22(28)29-14-30-23(19)34/h7-10,14-15,18,20-21,24H,11-13H2,1-6H3,(H,32,35)(H2,28,29,30)/t18-,20-,21-,24?/m1/s1 |
| InChIKey | YGEDYAIJOASLNR-BPOYXTRHSA-N |
| XLogP | 3.30 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |