C18H29N7O4 — CID 25231649
O-[4-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]butyl]hydroxylamine (PubChem CID 25231649) has the molecular formula C18H29N7O4 and a molecular weight of 407.48 g/mol. Its IUPAC name is O-[4-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]butyl]hydroxylamine.
| Compound Name | O-[4-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]butyl]hydroxylamine |
|---|---|
| PubChem CID | 25231649 |
| Molecular Formula | C18H29N7O4 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | O-[4-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]butyl]hydroxylamine |
| SMILES | CN(CCCCON)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H29N7O4/c1-18(2)28-13-11(8-24(3)6-4-5-7-26-20)27-17(14(13)29-18)25-10-23-12-15(19)21-9-22-16(12)25/h9-11,13-14,17H,4-8,20H2,1-3H3,(H2,19,21,22)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | NEBPBGYQUFMDNN-LSCFUAHRSA-N |
| XLogP | 0.43 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|