C30H43N7O4 — CID 159176603
6-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-N-(4-tert-butylphenyl)hexanamide (PubChem CID 159176603) has the molecular formula C30H43N7O4 and a molecular weight of 565.72 g/mol. Its IUPAC name is 6-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-N-(4-tert-butylphenyl)hexanamide.
| Compound Name | 6-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-N-(4-tert-butylphenyl)hexanamide |
|---|---|
| PubChem CID | 159176603 |
| Molecular Formula | C30H43N7O4 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | 6-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-N-(4-tert-butylphenyl)hexanamide |
| SMILES | CN(CCCCCC(=O)Nc1ccc(C(C)(C)C)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C30H43N7O4/c1-29(2,3)19-11-13-20(14-12-19)35-22(38)10-8-7-9-15-36(6)16-21-24-25(41-30(4,5)40-24)28(39-21)37-18-34-23-26(31)32-17-33-27(23)37/h11-14,17-18,21,24-25,28H,7-10,15-16H2,1-6H3,(H,35,38)(H2,31,32,33)/t21-,24-,25-,28-/m1/s1 |
| InChIKey | PCWUOHVBGIUWSI-VGSCBBJJSA-N |
| XLogP | 4.25 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|