C28H39FN8O4 — CID 86702417
1-[3-[[(4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-3-(4-tert-butyl-3-fluorophenyl)urea (PubChem CID 86702417) has the molecular formula C28H39FN8O4 and a molecular weight of 570.67 g/mol. Its IUPAC name is 1-[3-[[(4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-3-(4-tert-butyl-3-fluorophenyl)urea.
| Compound Name | 1-[3-[[(4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-3-(4-tert-butyl-3-fluorophenyl)urea |
|---|---|
| PubChem CID | 86702417 |
| Molecular Formula | C28H39FN8O4 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 1-[3-[[(4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-3-(4-tert-butyl-3-fluorophenyl)urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(C(C)(C)C)c(F)c1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C28H39FN8O4/c1-27(2,3)17-9-8-16(12-18(17)29)35-26(38)31-10-7-11-36(6)13-19-21-22(41-28(4,5)40-21)25(39-19)37-15-34-20-23(30)32-14-33-24(20)37/h8-9,12,14-15,19,21-22,25H,7,10-11,13H2,1-6H3,(H2,30,32,33)(H2,31,35,38)/t19-,21-,22?,25-/m1/s1 |
| InChIKey | ZHULXMHPGIYBEZ-NCEBOXNYSA-N |
| XLogP | 3.41 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|