C20H31N7O5 — CID 67973684
[4-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2-methylbutan-2-yl]carbamic acid (PubChem CID 67973684) has the molecular formula C20H31N7O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is [4-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2-methylbutan-2-yl]carbamic acid.
| Compound Name | [4-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2-methylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67973684 |
| Molecular Formula | C20H31N7O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | [4-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2-methylbutan-2-yl]carbamic acid |
| SMILES | CN(CCC(C)(C)NC(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H31N7O5/c1-19(2,25-18(28)29)6-7-26(5)8-11-13-14(32-20(3,4)31-13)17(30-11)27-10-24-12-15(21)22-9-23-16(12)27/h9-11,13-14,17,25H,6-8H2,1-5H3,(H,28,29)(H2,21,22,23)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | CWLQZYISKLHIDS-LSCFUAHRSA-N |
| XLogP | 1.19 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |