C18H27N7O7S — CID 134953699
tert-butyl N-[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N-sulfamoylcarbamate (PubChem CID 134953699) has the molecular formula C18H27N7O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is tert-butyl N-[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N-sulfamoylcarbamate.
| Compound Name | tert-butyl N-[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N-sulfamoylcarbamate |
|---|---|
| PubChem CID | 134953699 |
| Molecular Formula | C18H27N7O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | tert-butyl N-[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N-sulfamoylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1OC(n2cnc3c(N)ncnc32)C2OC(C)(C)OC12)S(N)(=O)=O |
| InChI | InChI=1S/C18H27N7O7S/c1-17(2,3)32-16(26)25(33(20,27)28)6-9-11-12(31-18(4,5)30-11)15(29-9)24-8-23-10-13(19)21-7-22-14(10)24/h7-9,11-12,15H,6H2,1-5H3,(H2,19,21,22)(H2,20,27,28) |
| InChIKey | YDUMMMXHBCZMFG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 187.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |