C21H30N6O6 — CID 67975495
5-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]-5-oxopentanoic acid (PubChem CID 67975495) has the molecular formula C21H30N6O6 and a molecular weight of 462.51 g/mol. Its IUPAC name is 5-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67975495 |
| Molecular Formula | C21H30N6O6 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 5-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]-5-oxopentanoic acid |
| SMILES | CC(C)N(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21)C(=O)CCCC(=O)O |
| InChI | InChI=1S/C21H30N6O6/c1-11(2)26(13(28)6-5-7-14(29)30)8-12-16-17(33-21(3,4)32-16)20(31-12)27-10-25-15-18(22)23-9-24-19(15)27/h9-12,16-17,20H,5-8H2,1-4H3,(H,29,30)(H2,22,23,24)/t12-,16-,17-,20-/m1/s1 |
| InChIKey | WKKJVGXLLNDJOM-QQRWZLOUSA-N |
| XLogP | 1.32 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |