C17H27N7O3 — CID 67989170
N'-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N'-ethylethane-1,2-diamine (PubChem CID 67989170) has the molecular formula C17H27N7O3 and a molecular weight of 377.45 g/mol. Its IUPAC name is N'-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N'-ethylethane-1,2-diamine.
| Compound Name | N'-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 67989170 |
| Molecular Formula | C17H27N7O3 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N'-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H27N7O3/c1-4-23(6-5-18)7-10-12-13(27-17(2,3)26-12)16(25-10)24-9-22-11-14(19)20-8-21-15(11)24/h8-10,12-13,16H,4-7,18H2,1-3H3,(H2,19,20,21)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | RUCYCNMZVKBWTO-XNIJJKJLSA-N |
| XLogP | 0.11 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |