C13H17N8O3+ — CID 6332755
[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylimino-iminoazanium (PubChem CID 6332755) has the molecular formula C13H17N8O3+ and a molecular weight of 333.33 g/mol. Its IUPAC name is [4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylimino-iminoazanium.
| Compound Name | [4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylimino-iminoazanium |
|---|---|
| PubChem CID | 6332755 |
| Molecular Formula | C13H17N8O3+ |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | [4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylimino-iminoazanium |
| SMILES | CC1(C)OC2C(CN=[N+]=N)OC(n3cnc4c(N)ncnc43)C2O1 |
| InChI | InChI=1S/C13H17N8O3/c1-13(2)23-8-6(3-19-20-15)22-12(9(8)24-13)21-5-18-7-10(14)16-4-17-11(7)21/h4-6,8-9,12,15H,3H2,1-2H3,(H2,14,16,17)/q+1 |
| InChIKey | VJYGFYCGAWVIDU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|