C18H29N7O4 — CID 25181588
2-[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-[3-aminopropyl(methyl)amino]ethanol (PubChem CID 25181588) has the molecular formula C18H29N7O4 and a molecular weight of 407.48 g/mol. Its IUPAC name is 2-[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-[3-aminopropyl(methyl)amino]ethanol.
| Compound Name | 2-[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-[3-aminopropyl(methyl)amino]ethanol |
|---|---|
| PubChem CID | 25181588 |
| Molecular Formula | C18H29N7O4 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-[3-aminopropyl(methyl)amino]ethanol |
| SMILES | CN(CCCN)C(O)C[C@H]1OC(n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H29N7O4/c1-18(2)28-13-10(7-11(26)24(3)6-4-5-19)27-17(14(13)29-18)25-9-23-12-15(20)21-8-22-16(12)25/h8-11,13-14,17,26H,4-7,19H2,1-3H3,(H2,20,21,22)/t10-,11?,13-,14-,17?/m1/s1 |
| InChIKey | GWFIVBPFBSYMMJ-SSNFAGSUSA-N |
| XLogP | -0.18 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|