C19H31N5O4Si — CID 168832119
9-[(3aR,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 168832119) has the molecular formula C19H31N5O4Si and a molecular weight of 421.57 g/mol. Its IUPAC name is 9-[(3aR,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[(3aR,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 168832119 |
| Molecular Formula | C19H31N5O4Si |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 9-[(3aR,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | CC1(C)OC2[C@H](CO[Si](C)(C)C(C)(C)C)O[C@H](n3cnc4c(N)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C19H31N5O4Si/c1-18(2,3)29(6,7)25-8-11-13-14(28-19(4,5)27-13)17(26-11)24-10-23-12-15(20)21-9-22-16(12)24/h9-11,13-14,17H,8H2,1-7H3,(H2,20,21,22)/t11-,13?,14+,17-/m0/s1 |
| InChIKey | PINPFPJUOAYYIQ-UFLXHATESA-N |
| XLogP | 2.85 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|