C20H33N5O3Si — CID 22297996
9-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 22297996) has the molecular formula C20H33N5O3Si and a molecular weight of 419.60 g/mol. Its IUPAC name is 9-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 22297996 |
| Molecular Formula | C20H33N5O3Si |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 9-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | CC1(C)OC2C(CO[Si](C)(C)C(C)(C)C)CC(n3cnc4c(N)ncnc43)C2O1 |
| InChI | InChI=1S/C20H33N5O3Si/c1-19(2,3)29(6,7)26-9-12-8-13(16-15(12)27-20(4,5)28-16)25-11-24-14-17(21)22-10-23-18(14)25/h10-13,15-16H,8-9H2,1-7H3,(H2,21,22,23) |
| InChIKey | YIBHUUUOMIGUBU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|