C21H32ClN3O3Si — CID 140776531
[(3aS,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 140776531) has the molecular formula C21H32ClN3O3Si and a molecular weight of 438.04 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140776531 |
| Molecular Formula | C21H32ClN3O3Si |
| Molecular Weight | 438.04 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](n3ccc4c(Cl)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C21H32ClN3O3Si/c1-20(2,3)29(6,7)26-11-13-10-15(17-16(13)27-21(4,5)28-17)25-9-8-14-18(22)23-12-24-19(14)25/h8-9,12-13,15-17H,10-11H2,1-7H3/t13-,15-,16-,17+/m1/s1 |
| InChIKey | GTMLNONABUKSDR-DZUCGIPZSA-N |
| XLogP | 5.19 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.04 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|