C21H30Cl2IN3O3Si — CID 174041992
[(3aS,4R,6R,6aR)-4-(2,4-dichloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 174041992) has the molecular formula C21H30Cl2IN3O3Si and a molecular weight of 598.39 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-(2,4-dichloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4R,6R,6aR)-4-(2,4-dichloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174041992 |
| Molecular Formula | C21H30Cl2IN3O3Si |
| Molecular Weight | 598.39 g/mol |
| Exact Mass | 597.05 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-(2,4-dichloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](n3cc(I)c4c(Cl)nc(Cl)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C21H30Cl2IN3O3Si/c1-20(2,3)31(6,7)28-10-11-8-13(16-15(11)29-21(4,5)30-16)27-9-12(24)14-17(22)25-19(23)26-18(14)27/h9,11,13,15-16H,8,10H2,1-7H3/t11-,13-,15-,16+/m1/s1 |
| InChIKey | WJWOBXNCHOZMKD-CUBALJKWSA-N |
| XLogP | 6.45 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.39 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|