C17H25ClIN3O4Si — CID 11734107
(2S,3S,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 11734107) has the molecular formula C17H25ClIN3O4Si and a molecular weight of 525.85 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11734107 |
| Molecular Formula | C17H25ClIN3O4Si |
| Molecular Weight | 525.85 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | (2S,3S,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](n2cc(I)c3c(Cl)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H25ClIN3O4Si/c1-17(2,3)27(4,5)25-7-10-12(23)13(24)16(26-10)22-6-9(19)11-14(18)20-8-21-15(11)22/h6,8,10,12-13,16,23-24H,7H2,1-5H3/t10-,12+,13+,16+/m0/s1 |
| InChIKey | PTTSKMQGGAMBAQ-MZXFEWSRSA-N |
| XLogP | 3.33 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|