C11H10Cl2IN3O3 — CID 57063340
(2R,3S,4R,5S)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-5-(chloromethyl)oxolane-3,4-diol (PubChem CID 57063340) has the molecular formula C11H10Cl2IN3O3 and a molecular weight of 430.03 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-5-(chloromethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-5-(chloromethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57063340 |
| Molecular Formula | C11H10Cl2IN3O3 |
| Molecular Weight | 430.03 g/mol |
| Exact Mass | 428.91 |
| IUPAC Name | (2R,3S,4R,5S)-2-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-5-(chloromethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H](n2cc(I)c3c(Cl)ncnc32)O[C@@H]1CCl |
| InChI | InChI=1S/C11H10Cl2IN3O3/c12-1-5-7(18)8(19)11(20-5)17-2-4(14)6-9(13)15-3-16-10(6)17/h2-3,5,7-8,11,18-19H,1H2/t5-,7+,8+,11-/m1/s1 |
| InChIKey | IMYHUNLPLUPLEG-LEIICMHDSA-N |
| XLogP | 1.55 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.03 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|