C10H11ClIN5O3 — CID 46876059
(3R,4S,5S)-2-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-5-(chloromethyl)oxolane-3,4-diol (PubChem CID 46876059) has the molecular formula C10H11ClIN5O3 and a molecular weight of 411.59 g/mol. Its IUPAC name is (3R,4S,5S)-2-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-5-(chloromethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5S)-2-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-5-(chloromethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46876059 |
| Molecular Formula | C10H11ClIN5O3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | (3R,4S,5S)-2-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-5-(chloromethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1c(I)nn2C1O[C@H](CCl)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H11ClIN5O3/c11-1-3-5(18)6(19)10(20-3)17-9-4(7(12)16-17)8(13)14-2-15-9/h2-3,5-6,10,18-19H,1H2,(H2,13,14,15)/t3-,5-,6-,10?/m1/s1 |
| InChIKey | BAEHESBBPXNPGW-RMXRYUSWSA-N |
| XLogP | -0.13 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|