C10H12IN5O5 — CID 68903185
(2R,3R,4S,5R)-2-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 68903185) has the molecular formula C10H12IN5O5 and a molecular weight of 409.14 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 68903185 |
| Molecular Formula | C10H12IN5O5 |
| Molecular Weight | 409.14 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1c(I)nn2O[C@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12IN5O5/c11-7-4-8(12)13-2-14-9(4)16(15-7)21-10-6(19)5(18)3(1-17)20-10/h2-3,5-6,10,17-19H,1H2,(H2,12,13,14)/t3-,5-,6-,10-/m1/s1 |
| InChIKey | CGIFAJPEPZYIRM-BHBWVORQSA-N |
| XLogP | -2.12 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.14 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|