C22H20ClN5O3 — CID 57074078
(2R,3S,4R,5S)-2-(4-anilino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)-5-(chloromethyl)oxolane-3,4-diol (PubChem CID 57074078) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(4-anilino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)-5-(chloromethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(4-anilino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)-5-(chloromethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57074078 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (2R,3S,4R,5S)-2-(4-anilino-3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)-5-(chloromethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H](n2nc(-c3ccccc3)c3c(Nc4ccccc4)ncnc32)O[C@@H]1CCl |
| InChI | InChI=1S/C22H20ClN5O3/c23-11-15-18(29)19(30)22(31-15)28-21-16(17(27-28)13-7-3-1-4-8-13)20(24-12-25-21)26-14-9-5-2-6-10-14/h1-10,12,15,18-19,22,29-30H,11H2,(H,24,25,26)/t15-,18+,19+,22-/m1/s1 |
| InChIKey | DDKSMBKYIUGXLD-JHGBEIFQSA-N |
| XLogP | 3.09 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|