C27H31N5O4 — CID 18664751
(2R,3R,4S,5S)-2-[4-[4-[2-(dimethylamino)ethyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 18664751) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[4-[4-[2-(dimethylamino)ethyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[4-[4-[2-(dimethylamino)ethyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 18664751 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (2R,3R,4S,5S)-2-[4-[4-[2-(dimethylamino)ethyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CN(C)CCc1ccc(Nc2ncnc3c2c(-c2ccccc2)cn3[C@@H]2O[C@@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C27H31N5O4/c1-31(2)13-12-17-8-10-19(11-9-17)30-25-22-20(18-6-4-3-5-7-18)14-32(26(22)29-16-28-25)27-24(35)23(34)21(15-33)36-27/h3-11,14,16,21,23-24,27,33-35H,12-13,15H2,1-2H3,(H,28,29,30)/t21-,23+,24+,27+/m0/s1 |
| InChIKey | XGDBZMMJHOGOFU-UCXAEWMPSA-N |
| XLogP | 2.56 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |