C27H31N5O3 — CID 22883196
(2R,3R,4S,5R)-2-[4-[2-[2-(dimethylamino)ethyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-methyloxolane-3,4-diol (PubChem CID 22883196) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-[2-[2-(dimethylamino)ethyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-[2-[2-(dimethylamino)ethyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 22883196 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-[2-[2-(dimethylamino)ethyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cc(-c3ccccc3)c3c(Nc4ccccc4CCN(C)C)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H31N5O3/c1-17-23(33)24(34)27(35-17)32-15-20(18-9-5-4-6-10-18)22-25(28-16-29-26(22)32)30-21-12-8-7-11-19(21)13-14-31(2)3/h4-12,15-17,23-24,27,33-34H,13-14H2,1-3H3,(H,28,29,30)/t17-,23-,24-,27-/m1/s1 |
| InChIKey | AINFQXRLNICODP-ZHKMAXBCSA-N |
| XLogP | 3.59 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |