C30H37N5O3 — CID 175677556
(2R,3R,4S,5R)-2-[4-[4-[3-(diethylamino)propyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-methyloxolane-3,4-diol (PubChem CID 175677556) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-[4-[3-(diethylamino)propyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-[4-[3-(diethylamino)propyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 175677556 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-[4-[3-(diethylamino)propyl]anilino]-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-5-methyloxolane-3,4-diol |
| SMILES | CCN(CC)CCCc1ccc(Nc2ncnc3c2c(-c2ccccc2)cn3[C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H37N5O3/c1-4-34(5-2)17-9-10-21-13-15-23(16-14-21)33-28-25-24(22-11-7-6-8-12-22)18-35(29(25)32-19-31-28)30-27(37)26(36)20(3)38-30/h6-8,11-16,18-20,26-27,30,36-37H,4-5,9-10,17H2,1-3H3,(H,31,32,33)/t20-,26-,27-,30-/m1/s1 |
| InChIKey | OIAIIBXYXBQKGA-OEGZMODRSA-N |
| XLogP | 4.76 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |