C23H21FN4O3 — CID 57301565
(2R,3R,4S,5S)-2-(4-anilino-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(fluoromethyl)oxolane-3,4-diol (PubChem CID 57301565) has the molecular formula C23H21FN4O3 and a molecular weight of 420.44 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(4-anilino-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(fluoromethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(4-anilino-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(fluoromethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57301565 |
| Molecular Formula | C23H21FN4O3 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (2R,3R,4S,5S)-2-(4-anilino-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(fluoromethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CF)O[C@H]1n1cc(-c2ccccc2)c2c(Nc3ccccc3)ncnc21 |
| InChI | InChI=1S/C23H21FN4O3/c24-11-17-19(29)20(30)23(31-17)28-12-16(14-7-3-1-4-8-14)18-21(25-13-26-22(18)28)27-15-9-5-2-6-10-15/h1-10,12-13,17,19-20,23,29-30H,11H2,(H,25,26,27)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | NZTBSJXXNKYRQA-ZDXOVATRSA-N |
| XLogP | 3.43 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |