C23H23N5O4 — CID 67639634
(2R,3R,4S,5S)-2-[4-anilino-3-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-5-methyloxolane-3,4-diol (PubChem CID 67639634) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[4-anilino-3-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[4-anilino-3-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 67639634 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (2R,3R,4S,5S)-2-[4-anilino-3-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]-5-methyloxolane-3,4-diol |
| SMILES | COc1ccc(-c2nn([C@@H]3O[C@@H](C)[C@@H](O)[C@H]3O)c3ncnc(Nc4ccccc4)c23)cc1 |
| InChI | InChI=1S/C23H23N5O4/c1-13-19(29)20(30)23(32-13)28-22-17(18(27-28)14-8-10-16(31-2)11-9-14)21(24-12-25-22)26-15-6-4-3-5-7-15/h3-13,19-20,23,29-30H,1-2H3,(H,24,25,26)/t13-,19+,20+,23+/m0/s1 |
| InChIKey | ASKLYCWUEYNTCZ-LLJRXWLJSA-N |
| XLogP | 2.88 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |