C23H21N7O3 — CID 57226005
4-[[1-[(2R,3S,4R,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]benzonitrile (PubChem CID 57226005) has the molecular formula C23H21N7O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is 4-[[1-[(2R,3S,4R,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[1-[(2R,3S,4R,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 57226005 |
| Molecular Formula | C23H21N7O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 4-[[1-[(2R,3S,4R,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]-3-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ncnc3c2c(-c2ccccc2)nn3[C@@H]2O[C@H](CN)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C23H21N7O3/c24-10-13-6-8-15(9-7-13)28-21-17-18(14-4-2-1-3-5-14)29-30(22(17)27-12-26-21)23-20(32)19(31)16(11-25)33-23/h1-9,12,16,19-20,23,31-32H,11,25H2,(H,26,27,28)/t16-,19+,20+,23-/m1/s1 |
| InChIKey | STBBQAOVQSDCJF-KNLNXMFASA-N |
| XLogP | 1.69 |
| TPSA | 155.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |