C11H13IN4O3 — CID 11740220
(2R,3S,4R,5R)-2-(aminomethyl)-5-(5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 11740220) has the molecular formula C11H13IN4O3 and a molecular weight of 376.15 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(aminomethyl)-5-(5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(aminomethyl)-5-(5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11740220 |
| Molecular Formula | C11H13IN4O3 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | (2R,3S,4R,5R)-2-(aminomethyl)-5-(5-iodopyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | NC[C@H]1O[C@@H](n2cc(I)c3cncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H13IN4O3/c12-6-3-16(10-5(6)2-14-4-15-10)11-9(18)8(17)7(1-13)19-11/h2-4,7-9,11,17-18H,1,13H2/t7-,8-,9-,11-/m1/s1 |
| InChIKey | BGIROOQCPBOBNS-TURQNECASA-N |
| XLogP | -0.39 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|