C10H13N4O7P — CID 163766650
[(2R,3R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 163766650) has the molecular formula C10H13N4O7P and a molecular weight of 332.21 g/mol. Its IUPAC name is [(2R,3R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 163766650 |
| Molecular Formula | C10H13N4O7P |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [(2R,3R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](n2cnc3cncnc32)C(O)[C@H]1O |
| InChI | InChI=1S/C10H13N4O7P/c15-7-6(2-20-22(17,18)19)21-10(8(7)16)14-4-13-5-1-11-3-12-9(5)14/h1,3-4,6-8,10,15-16H,2H2,(H2,17,18,19)/t6-,7+,8?,10-/m1/s1 |
| InChIKey | MCWDCZIDTUQRHK-KIUGWDQWSA-N |
| XLogP | -1.45 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|