C12H17N4O6P — CID 76783715
[4-hydroxy-2-(methoxymethyl)-5-purin-9-yloxolan-3-yl]oxy-methylphosphinic acid (PubChem CID 76783715) has the molecular formula C12H17N4O6P and a molecular weight of 344.26 g/mol. Its IUPAC name is [4-hydroxy-2-(methoxymethyl)-5-purin-9-yloxolan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [4-hydroxy-2-(methoxymethyl)-5-purin-9-yloxolan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 76783715 |
| Molecular Formula | C12H17N4O6P |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [4-hydroxy-2-(methoxymethyl)-5-purin-9-yloxolan-3-yl]oxy-methylphosphinic acid |
| SMILES | COCC1OC(n2cnc3cncnc32)C(O)C1OP(C)(=O)O |
| InChI | InChI=1S/C12H17N4O6P/c1-20-4-8-10(22-23(2,18)19)9(17)12(21-8)16-6-15-7-3-13-5-14-11(7)16/h3,5-6,8-10,12,17H,4H2,1-2H3,(H,18,19) |
| InChIKey | SOLXCNKOMHWYEK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|