C17H28N4O3Si — CID 159661828
(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-purin-9-yloxolan-3-ol (PubChem CID 159661828) has the molecular formula C17H28N4O3Si and a molecular weight of 364.52 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-purin-9-yloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-purin-9-yloxolan-3-ol |
|---|---|
| PubChem CID | 159661828 |
| Molecular Formula | C17H28N4O3Si |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-purin-9-yloxolan-3-ol |
| SMILES | CC[C@H]1O[C@@H](n2cnc3cncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C17H28N4O3Si/c1-7-12-13(22)14(24-25(5,6)17(2,3)4)16(23-12)21-10-20-11-8-18-9-19-15(11)21/h8-10,12-14,16,22H,7H2,1-6H3/t12-,13-,14-,16-/m1/s1 |
| InChIKey | PGANLZCVZRRXQA-IXYNUQLISA-N |
| XLogP | 2.88 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|