C18H28N4O — CID 174181937
9-[(2R,4S)-4-tert-butyl-5-(2,2-dimethylpropyl)oxolan-2-yl]purine (PubChem CID 174181937) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 9-[(2R,4S)-4-tert-butyl-5-(2,2-dimethylpropyl)oxolan-2-yl]purine.
| Compound Name | 9-[(2R,4S)-4-tert-butyl-5-(2,2-dimethylpropyl)oxolan-2-yl]purine |
|---|---|
| PubChem CID | 174181937 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 9-[(2R,4S)-4-tert-butyl-5-(2,2-dimethylpropyl)oxolan-2-yl]purine |
| SMILES | CC(C)(C)CC1O[C@@H](n2cnc3cncnc32)C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C18H28N4O/c1-17(2,3)8-14-12(18(4,5)6)7-15(23-14)22-11-21-13-9-19-10-20-16(13)22/h9-12,14-15H,7-8H2,1-6H3/t12-,14?,15-/m1/s1 |
| InChIKey | SJLBRQZDVHMQTO-SULGFLJSSA-N |
| XLogP | 4.21 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |