C9H10N4O3 — CID 70292310
[(2S,4S)-2-purin-9-yl-1,3-dioxolan-4-yl]methanol (PubChem CID 70292310) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is [(2S,4S)-2-purin-9-yl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(2S,4S)-2-purin-9-yl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 70292310 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | [(2S,4S)-2-purin-9-yl-1,3-dioxolan-4-yl]methanol |
| SMILES | OC[C@H]1CO[C@H](n2cnc3cncnc32)O1 |
| InChI | InChI=1S/C9H10N4O3/c14-2-6-3-15-9(16-6)13-5-12-7-1-10-4-11-8(7)13/h1,4-6,9,14H,2-3H2/t6-,9-/m0/s1 |
| InChIKey | CBBUPWRIFIXGBP-RCOVLWMOSA-N |
| XLogP | -0.31 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |