C9H8N4O4 — CID 16737831
(3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-one (PubChem CID 16737831) has the molecular formula C9H8N4O4 and a molecular weight of 236.19 g/mol. Its IUPAC name is (3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-one.
| Compound Name | (3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-one |
|---|---|
| PubChem CID | 16737831 |
| Molecular Formula | C9H8N4O4 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-one |
| SMILES | O=C1O[C@@H](n2cnc3cncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H8N4O4/c14-5-6(15)9(16)17-8(5)13-3-12-4-1-10-2-11-7(4)13/h1-3,5-6,8,14-15H/t5-,6+,8-/m1/s1 |
| InChIKey | PZIPRLBDYLTVKA-GKROBHDKSA-N |
| XLogP | -1.40 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |