C17H17N5O6S — CID 87081441
(2S,3S,4R,5R)-2-(2-nitro-2-phenyl-1-sulfanyloxyethyl)-5-purin-9-yloxolane-3,4-diol (PubChem CID 87081441) has the molecular formula C17H17N5O6S and a molecular weight of 419.42 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(2-nitro-2-phenyl-1-sulfanyloxyethyl)-5-purin-9-yloxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(2-nitro-2-phenyl-1-sulfanyloxyethyl)-5-purin-9-yloxolane-3,4-diol |
|---|---|
| PubChem CID | 87081441 |
| Molecular Formula | C17H17N5O6S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (2S,3S,4R,5R)-2-(2-nitro-2-phenyl-1-sulfanyloxyethyl)-5-purin-9-yloxolane-3,4-diol |
| SMILES | O=[N+]([O-])C(c1ccccc1)C(OS)[C@H]1O[C@@H](n2cnc3cncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H17N5O6S/c23-12-13(24)17(21-8-20-10-6-18-7-19-16(10)21)27-15(12)14(28-29)11(22(25)26)9-4-2-1-3-5-9/h1-8,11-15,17,23-24,29H/t11?,12-,13+,14?,15-,17+/m0/s1 |
| InChIKey | BGZBQEZGQXHPNW-DDRDWXHXSA-N |
| XLogP | 0.69 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|