C12H17N5O3S — CID 54190957
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(1-sulfanylpropyl)oxolane-3,4-diol (PubChem CID 54190957) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(1-sulfanylpropyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(1-sulfanylpropyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54190957 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(1-sulfanylpropyl)oxolane-3,4-diol |
| SMILES | CCC(S)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H17N5O3S/c1-2-5(21)9-7(18)8(19)12(20-9)17-4-16-6-10(13)14-3-15-11(6)17/h3-5,7-9,12,18-19,21H,2H2,1H3,(H2,13,14,15)/t5?,7-,8+,9+,12+/m0/s1 |
| InChIKey | PIMAWOCJUXRTHD-DEVJFJGASA-N |
| XLogP | -0.26 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|