C12H17N5O5S — CID 102317448
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[hydroxy(2-hydroxyethylsulfanyl)methyl]oxolane-3,4-diol (PubChem CID 102317448) has the molecular formula C12H17N5O5S and a molecular weight of 343.37 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[hydroxy(2-hydroxyethylsulfanyl)methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[hydroxy(2-hydroxyethylsulfanyl)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 102317448 |
| Molecular Formula | C12H17N5O5S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[hydroxy(2-hydroxyethylsulfanyl)methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(O)SCCO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17N5O5S/c13-9-5-10(15-3-14-9)17(4-16-5)11-7(20)6(19)8(22-11)12(21)23-2-1-18/h3-4,6-8,11-12,18-21H,1-2H2,(H2,13,14,15)/t6-,7+,8-,11+,12?/m0/s1 |
| InChIKey | YUXMECGKRUHIHM-LWKXBLANSA-N |
| XLogP | -1.93 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|