C12H17N5O3S2 — CID 23253577
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[bis(methylsulfanyl)methyl]oxolane-3,4-diol (PubChem CID 23253577) has the molecular formula C12H17N5O3S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[bis(methylsulfanyl)methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[bis(methylsulfanyl)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 23253577 |
| Molecular Formula | C12H17N5O3S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[bis(methylsulfanyl)methyl]oxolane-3,4-diol |
| SMILES | CSC(SC)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H17N5O3S2/c1-21-12(22-2)8-6(18)7(19)11(20-8)17-4-16-5-9(13)14-3-15-10(5)17/h3-4,6-8,11-12,18-19H,1-2H3,(H2,13,14,15)/t6-,7+,8-,11+/m0/s1 |
| InChIKey | XRXPKYQGIGLHJQ-MCHASIABSA-N |
| XLogP | 0.08 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|