C22H30N10O6S2 — CID 159700299
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(1-hydroxyethyl)-4-sulfanyloxolan-3-ol;(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 159700299) has the molecular formula C22H30N10O6S2 and a molecular weight of 594.68 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(1-hydroxyethyl)-4-sulfanyloxolan-3-ol;(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(1-hydroxyethyl)-4-sulfanyloxolan-3-ol;(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 159700299 |
| Molecular Formula | C22H30N10O6S2 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(1-hydroxyethyl)-4-sulfanyloxolan-3-ol;(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | CC(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](S)[C@@H]1O.CSC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/2C11H15N5O3S/c1-20-2-5-7(17)8(18)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16;1-4(17)7-6(18)8(20)11(19-7)16-3-15-5-9(12)13-2-14-10(5)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14);2-4,6-8,11,17-18,20H,1H3,(H2,12,13,14)/t5-,7-,8-,11-;4?,6-,7-,8-,11-/m11/s1 |
| InChIKey | MXNOACFGWSIKLG-MRYJZQRBSA-N |
| XLogP | -1.26 |
| TPSA | 238.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|