C18H29N5O4 — CID 54307650
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(1-butoxypentyl)oxolane-3,4-diol (PubChem CID 54307650) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(1-butoxypentyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(1-butoxypentyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54307650 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(1-butoxypentyl)oxolane-3,4-diol |
| SMILES | CCCCOC(CCCC)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H29N5O4/c1-3-5-7-11(26-8-6-4-2)15-13(24)14(25)18(27-15)23-10-22-12-16(19)20-9-21-17(12)23/h9-11,13-15,18,24-25H,3-8H2,1-2H3,(H2,19,20,21)/t11?,13-,14+,15+,18+/m0/s1 |
| InChIKey | SIQPLAIMXADDRS-VZHNOFLRSA-N |
| XLogP | 1.40 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|