C14H22ClN5NaO7P — CID 175500929
sodium;1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]pentyl dihydrogen phosphate;chloride (PubChem CID 175500929) has the molecular formula C14H22ClN5NaO7P and a molecular weight of 461.78 g/mol. Its IUPAC name is sodium;1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]pentyl dihydrogen phosphate;chloride.
| Compound Name | sodium;1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]pentyl dihydrogen phosphate;chloride |
|---|---|
| PubChem CID | 175500929 |
| Molecular Formula | C14H22ClN5NaO7P |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | sodium;1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]pentyl dihydrogen phosphate;chloride |
| SMILES | CCCCC(OP(=O)(O)O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O.[Cl-].[Na+] |
| InChI | InChI=1S/C14H22N5O7P.ClH.Na/c1-2-3-4-7(26-27(22,23)24)11-9(20)10(21)14(25-11)19-6-18-8-12(15)16-5-17-13(8)19;;/h5-7,9-11,14,20-21H,2-4H2,1H3,(H2,15,16,17)(H2,22,23,24);1H;/q;;+1/p-1/t7?,9-,10+,11+,14+;;/m0../s1 |
| InChIKey | KNMIYJBTVMMYQL-XGEQAGNWSA-M |
| XLogP | -6.30 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | -6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|