C18H31N5O7P2S — CID 88716126
[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]-dibutylphosphinothioyloxyphosphinic acid (PubChem CID 88716126) has the molecular formula C18H31N5O7P2S and a molecular weight of 523.49 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]-dibutylphosphinothioyloxyphosphinic acid.
| Compound Name | [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]-dibutylphosphinothioyloxyphosphinic acid |
|---|---|
| PubChem CID | 88716126 |
| Molecular Formula | C18H31N5O7P2S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]-dibutylphosphinothioyloxyphosphinic acid |
| SMILES | CCCCP(=S)(CCCC)OP(=O)(O)C(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H31N5O7P2S/c1-3-5-7-31(33,8-6-4-2)30-32(27,28)18(26)14-12(24)13(25)17(29-14)23-10-22-11-15(19)20-9-21-16(11)23/h9-10,12-14,17-18,24-26H,3-8H2,1-2H3,(H,27,28)(H2,19,20,21)/t12-,13+,14-,17+,18?/m0/s1 |
| InChIKey | CGDBKBIOSPDLCE-JSRCKDDZSA-N |
| XLogP | 1.54 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|