C12H20N7O7P — CID 87733568
(2S,3S,4R,5R)-2-[[[amino(ethoxy)phosphoryl]oxyamino]-hydroxymethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol (PubChem CID 87733568) has the molecular formula C12H20N7O7P and a molecular weight of 405.31 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[[[amino(ethoxy)phosphoryl]oxyamino]-hydroxymethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[[[amino(ethoxy)phosphoryl]oxyamino]-hydroxymethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 87733568 |
| Molecular Formula | C12H20N7O7P |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (2S,3S,4R,5R)-2-[[[amino(ethoxy)phosphoryl]oxyamino]-hydroxymethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
| SMILES | CCOP(N)(=O)ONC(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20N7O7P/c1-2-24-27(14,23)26-18-11(22)8-6(20)7(21)12(25-8)19-4-17-5-9(13)15-3-16-10(5)19/h3-4,6-8,11-12,18,20-22H,2H2,1H3,(H2,14,23)(H2,13,15,16)/t6-,7+,8-,11?,12+,27?/m0/s1 |
| InChIKey | QMSYFGQBDQMNAX-WGVTWYIUSA-N |
| XLogP | -2.03 |
| TPSA | 213.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|